About 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one
5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one (PubChem CID 84600770) has the molecular formula C14H15Cl2N5O
and a molecular weight of 340.21 g/mol. Its IUPAC name is 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one.
Molecular Properties
| Compound Name | 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one |
| PubChem CID | 84600770 |
| Molecular Formula | C14H15Cl2N5O |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one |
| SMILES | O=C1CCC(NCc2cn(-c3ccc(Cl)c(Cl)c3)nn2)CN1 |
| InChI | InChI=1S/C14H15Cl2N5O/c15-12-3-2-11(5-13(12)16)21-8-10(19-20-21)7-17-9-1-4-14(22)18-6-9/h2-3,5,8-9,17H,1,4,6-7H2,(H,18,22) |
| InChIKey | CFERUBODZZPEFD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one?
The IUPAC name of 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one (CID 84600770) is 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one.
What is the SMILES notation for 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one?
The canonical SMILES for 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one is O=C1CCC(NCc2cn(-c3ccc(Cl)c(Cl)c3)nn2)CN1.
What is the InChIKey of 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one?
The InChIKey is CFERUBODZZPEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N5O/c15-12-3-2-11(5-13(12)16)21-8-10(19-20-21)7-17-9-1-4-14(22)18-6-9/h2-3,5,8-9,17H,1,4,6-7H2,(H,18,22).
What are the key properties of 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one?
5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one has a molecular weight of 340.21 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]piperidin-2-one is sourced from PubChem (CID 84600770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).