About 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea
1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea (PubChem CID 84600787) has the molecular formula C17H25N5OS
and a molecular weight of 347.49 g/mol. Its IUPAC name is 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea.
Molecular Properties
| Compound Name | 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea |
| PubChem CID | 84600787 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea |
| SMILES | Cc1cnc(C(C)CNC(=O)NC2CCCCC2n2cccn2)s1 |
| InChI | InChI=1S/C17H25N5OS/c1-12(16-18-11-13(2)24-16)10-19-17(23)21-14-6-3-4-7-15(14)22-9-5-8-20-22/h5,8-9,11-12,14-15H,3-4,6-7,10H2,1-2H3,(H2,19,21,23) |
| InChIKey | ABWOFELGQCUJQO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea?
The IUPAC name of 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea (CID 84600787) is 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea.
What is the SMILES notation for 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea?
The canonical SMILES for 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea is Cc1cnc(C(C)CNC(=O)NC2CCCCC2n2cccn2)s1.
What is the InChIKey of 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea?
The InChIKey is ABWOFELGQCUJQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5OS/c1-12(16-18-11-13(2)24-16)10-19-17(23)21-14-6-3-4-7-15(14)22-9-5-8-20-22/h5,8-9,11-12,14-15H,3-4,6-7,10H2,1-2H3,(H2,19,21,23).
What are the key properties of 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea?
1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea has a molecular weight of 347.49 g/mol, XLogP of 3.23, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-methyl-1,3-thiazol-2-yl)propyl]-3-(2-pyrazol-1-ylcyclohexyl)urea is sourced from PubChem (CID 84600787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).