C16H24FN7O — CID 84601059
1-[2-(dimethylamino)ethyl]-3-[3-fluoro-4-(1-propan-2-yltetrazol-5-yl)phenyl]-1-methylurea (PubChem CID 84601059) has the molecular formula C16H24FN7O and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[3-fluoro-4-(1-propan-2-yltetrazol-5-yl)phenyl]-1-methylurea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[3-fluoro-4-(1-propan-2-yltetrazol-5-yl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 84601059 |
| Molecular Formula | C16H24FN7O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[3-fluoro-4-(1-propan-2-yltetrazol-5-yl)phenyl]-1-methylurea |
| SMILES | CC(C)n1nnnc1-c1ccc(NC(=O)N(C)CCN(C)C)cc1F |
| InChI | InChI=1S/C16H24FN7O/c1-11(2)24-15(19-20-21-24)13-7-6-12(10-14(13)17)18-16(25)23(5)9-8-22(3)4/h6-7,10-11H,8-9H2,1-5H3,(H,18,25) |
| InChIKey | LEBPTYVHSDOAKU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |