C16H22N2O3S — CID 84602163
tert-butyl 2-[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetate (PubChem CID 84602163) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is tert-butyl 2-[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 84602163 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl 2-[1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetate |
| SMILES | COCCn1c(SCC(=O)OC(C)(C)C)nc2ccccc21 |
| InChI | InChI=1S/C16H22N2O3S/c1-16(2,3)21-14(19)11-22-15-17-12-7-5-6-8-13(12)18(15)9-10-20-4/h5-8H,9-11H2,1-4H3 |
| InChIKey | YBJMSVCJQMVJRK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |