C19H18N2O4S — CID 84602448
1-(3,4-dimethoxyphenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)ethanone (PubChem CID 84602448) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)ethanone.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)ethanone |
|---|---|
| PubChem CID | 84602448 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)ethanone |
| SMILES | COc1ccc(C(=O)COc2ncnc3sc4c(c23)CCC4)cc1OC |
| InChI | InChI=1S/C19H18N2O4S/c1-23-14-7-6-11(8-15(14)24-2)13(22)9-25-18-17-12-4-3-5-16(12)26-19(17)21-10-20-18/h6-8,10H,3-5,9H2,1-2H3 |
| InChIKey | LDIVMXRZMGMVRM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |