C16H21F3N2O2 — CID 84602640
N-cyclohexyl-N-ethyl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 84602640) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-cyclohexyl-N-ethyl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 84602640 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-cyclohexyl-N-ethyl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CCN(C(=O)Cn1cc(C(F)(F)F)ccc1=O)C1CCCCC1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-2-21(13-6-4-3-5-7-13)15(23)11-20-10-12(16(17,18)19)8-9-14(20)22/h8-10,13H,2-7,11H2,1H3 |
| InChIKey | NZHGCPPLGDMWKK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |