C15H15Cl2N3O3S — CID 84602954
1-[[5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]pyrrolidin-2-one (PubChem CID 84602954) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 1-[[5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 84602954 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1-[[5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1nnc(SCCOc2c(Cl)cccc2Cl)o1 |
| InChI | InChI=1S/C15H15Cl2N3O3S/c16-10-3-1-4-11(17)14(10)22-7-8-24-15-19-18-12(23-15)9-20-6-2-5-13(20)21/h1,3-4H,2,5-9H2 |
| InChIKey | FSDNLXHRFAFREV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|