C14H16ClNO2S — CID 84603511
4-[2-(4-chlorophenoxy)ethylsulfanylmethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 84603511) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 4-[2-(4-chlorophenoxy)ethylsulfanylmethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[2-(4-chlorophenoxy)ethylsulfanylmethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 84603511 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[2-(4-chlorophenoxy)ethylsulfanylmethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1CSCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO2S/c1-10-14(11(2)18-16-10)9-19-8-7-17-13-5-3-12(15)4-6-13/h3-6H,7-9H2,1-2H3 |
| InChIKey | JXIRNXZPTOTWIV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|