C18H15FN4O3S — CID 84603540
4-fluoro-N'-[2-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 84603540) has the molecular formula C18H15FN4O3S and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-fluoro-N'-[2-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[2-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 84603540 |
| Molecular Formula | C18H15FN4O3S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-fluoro-N'-[2-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1ccccc1-c1nnc(SCC(=O)NNC(=O)c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H15FN4O3S/c1-11-4-2-3-5-14(11)17-22-23-18(26-17)27-10-15(24)20-21-16(25)12-6-8-13(19)9-7-12/h2-9H,10H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | HIHBTWRXPCWEOZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|