C12H12N2OS — CID 84603555
2-(2-methylphenyl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole (PubChem CID 84603555) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-(2-methylphenyl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(2-methylphenyl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 84603555 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-(2-methylphenyl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=CCSc1nnc(-c2ccccc2C)o1 |
| InChI | InChI=1S/C12H12N2OS/c1-3-8-16-12-14-13-11(15-12)10-7-5-4-6-9(10)2/h3-7H,1,8H2,2H3 |
| InChIKey | RIMDEQXJXVVTPJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|