C23H21NO2 — CID 846043
N-[3-(2,3-dimethylbenzoyl)phenyl]-2-methylbenzamide (PubChem CID 846043) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[3-(2,3-dimethylbenzoyl)phenyl]-2-methylbenzamide.
| Compound Name | N-[3-(2,3-dimethylbenzoyl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 846043 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[3-(2,3-dimethylbenzoyl)phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(C(=O)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C23H21NO2/c1-15-9-6-13-21(17(15)3)22(25)18-10-7-11-19(14-18)24-23(26)20-12-5-4-8-16(20)2/h4-14H,1-3H3,(H,24,26) |
| InChIKey | JVYCVYLLPNWZOL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |