C14H19BrN2O2 — CID 84607841
2-[4-(4-bromo-2-methylphenyl)-6-methylpiperazin-2-yl]acetic acid (PubChem CID 84607841) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2-[4-(4-bromo-2-methylphenyl)-6-methylpiperazin-2-yl]acetic acid.
| Compound Name | 2-[4-(4-bromo-2-methylphenyl)-6-methylpiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 84607841 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-[4-(4-bromo-2-methylphenyl)-6-methylpiperazin-2-yl]acetic acid |
| SMILES | Cc1cc(Br)ccc1N1CC(C)NC(CC(=O)O)C1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-9-5-11(15)3-4-13(9)17-7-10(2)16-12(8-17)6-14(18)19/h3-5,10,12,16H,6-8H2,1-2H3,(H,18,19) |
| InChIKey | HRXSIGQVZLQXKT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |