C17H15BrN2 — CID 84608155
2-[2-(4-bromophenyl)pyrrolidin-1-yl]benzonitrile (PubChem CID 84608155) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 2-[2-(4-bromophenyl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 84608155 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-[2-(4-bromophenyl)pyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCCC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN2/c18-15-9-7-13(8-10-15)16-6-3-11-20(16)17-5-2-1-4-14(17)12-19/h1-2,4-5,7-10,16H,3,6,11H2 |
| InChIKey | XVTIWPJOAAJUCZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |