About 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol
2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol (PubChem CID 84608271) has the molecular formula C15H23BrN2O
and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol |
| PubChem CID | 84608271 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol |
| SMILES | CC1CCN(C)C(CCO)CN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H23BrN2O/c1-12-7-9-17(2)15(8-10-19)11-18(12)14-5-3-13(16)4-6-14/h3-6,12,15,19H,7-11H2,1-2H3 |
| InChIKey | KOCFXGQJHTUOIJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol?
The IUPAC name of 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol (CID 84608271) is 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol.
What is the SMILES notation for 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol?
The canonical SMILES for 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol is CC1CCN(C)C(CCO)CN1c1ccc(Br)cc1.
What is the InChIKey of 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol?
The InChIKey is KOCFXGQJHTUOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23BrN2O/c1-12-7-9-17(2)15(8-10-19)11-18(12)14-5-3-13(16)4-6-14/h3-6,12,15,19H,7-11H2,1-2H3.
What are the key properties of 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol?
2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol has a molecular weight of 327.27 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-bromophenyl)-1,5-dimethyl-1,4-diazepan-2-yl]ethanol is sourced from PubChem (CID 84608271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).