About 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine
2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine (PubChem CID 84610372) has the molecular formula C14H15BrN4O
and a molecular weight of 335.21 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine |
| PubChem CID | 84610372 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine |
| SMILES | CNCCc1nc(-c2ccc3ncoc3c2)c(Br)n1C |
| InChI | InChI=1S/C14H15BrN4O/c1-16-6-5-12-18-13(14(15)19(12)2)9-3-4-10-11(7-9)20-8-17-10/h3-4,7-8,16H,5-6H2,1-2H3 |
| InChIKey | AGEZOWNDRJNHNC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine?
The IUPAC name of 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine (CID 84610372) is 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine.
What is the SMILES notation for 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine?
The canonical SMILES for 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine is CNCCc1nc(-c2ccc3ncoc3c2)c(Br)n1C.
What is the InChIKey of 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine?
The InChIKey is AGEZOWNDRJNHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN4O/c1-16-6-5-12-18-13(14(15)19(12)2)9-3-4-10-11(7-9)20-8-17-10/h3-4,7-8,16H,5-6H2,1-2H3.
What are the key properties of 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine?
2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine has a molecular weight of 335.21 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-benzoxazol-6-yl)-5-bromo-1-methylimidazol-2-yl]-N-methylethanamine is sourced from PubChem (CID 84610372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).