C15H19BrN4 — CID 84610406
1-[[1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methyl]piperazine (PubChem CID 84610406) has the molecular formula C15H19BrN4 and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-[[1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methyl]piperazine.
| Compound Name | 1-[[1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 84610406 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-[[1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methyl]piperazine |
| SMILES | Cc1cc(-n2cc(CN3CCNCC3)cn2)ccc1Br |
| InChI | InChI=1S/C15H19BrN4/c1-12-8-14(2-3-15(12)16)20-11-13(9-18-20)10-19-6-4-17-5-7-19/h2-3,8-9,11,17H,4-7,10H2,1H3 |
| InChIKey | GWFHGERUVCCEMK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |