About 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole
5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole (PubChem CID 84610428) has the molecular formula C11H9BrCl2N2O
and a molecular weight of 336.02 g/mol. Its IUPAC name is 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole.
Molecular Properties
| Compound Name | 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole |
| PubChem CID | 84610428 |
| Molecular Formula | C11H9BrCl2N2O |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole |
| SMILES | COc1c(Cl)cc(Cl)cc1-c1nc(C)[nH]c1Br |
| InChI | InChI=1S/C11H9BrCl2N2O/c1-5-15-9(11(12)16-5)7-3-6(13)4-8(14)10(7)17-2/h3-4H,1-2H3,(H,15,16) |
| InChIKey | KPVZKDHGGSYSJG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole?
The IUPAC name of 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole (CID 84610428) is 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole.
What is the SMILES notation for 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole?
The canonical SMILES for 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole is COc1c(Cl)cc(Cl)cc1-c1nc(C)[nH]c1Br.
What is the InChIKey of 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole?
The InChIKey is KPVZKDHGGSYSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrCl2N2O/c1-5-15-9(11(12)16-5)7-3-6(13)4-8(14)10(7)17-2/h3-4H,1-2H3,(H,15,16).
What are the key properties of 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole?
5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole has a molecular weight of 336.02 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-(3,5-dichloro-2-methoxyphenyl)-2-methyl-1H-imidazole is sourced from PubChem (CID 84610428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).