C20H29N3O — CID 84613081
N-(2-aminoethyl)-6-tert-butyl-9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 84613081) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-tert-butyl-9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-6-tert-butyl-9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 84613081 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | N-(2-aminoethyl)-6-tert-butyl-9-methyl-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | Cn1c2c(c3cc(C(C)(C)C)ccc31)CC(C(=O)NCCN)CC2 |
| InChI | InChI=1S/C20H29N3O/c1-20(2,3)14-6-8-18-16(12-14)15-11-13(19(24)22-10-9-21)5-7-17(15)23(18)4/h6,8,12-13H,5,7,9-11,21H2,1-4H3,(H,22,24) |
| InChIKey | HYOMFYBCGWQQQP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|