C19H21N5O — CID 84613542
N-(3-aminophenyl)-3-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanamide (PubChem CID 84613542) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(3-aminophenyl)-3-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanamide.
| Compound Name | N-(3-aminophenyl)-3-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 84613542 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-(3-aminophenyl)-3-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanamide |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1CCC(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C19H21N5O/c1-13-17(14(2)24(23-13)18-8-3-4-11-21-18)9-10-19(25)22-16-7-5-6-15(20)12-16/h3-8,11-12H,9-10,20H2,1-2H3,(H,22,25) |
| InChIKey | ATYHJBWGWIRLQU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|