About 2-methyl-1,3-dihydroisoindole-5-carboxamide
2-methyl-1,3-dihydroisoindole-5-carboxamide (PubChem CID 84613951) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-methyl-1,3-dihydroisoindole-5-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-1,3-dihydroisoindole-5-carboxamide |
| PubChem CID | 84613951 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-methyl-1,3-dihydroisoindole-5-carboxamide |
| SMILES | CN1Cc2ccc(C(N)=O)cc2C1 |
| InChI | InChI=1S/C10H12N2O/c1-12-5-8-3-2-7(10(11)13)4-9(8)6-12/h2-4H,5-6H2,1H3,(H2,11,13) |
| InChIKey | SPRLUNSFMIAAFG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1,3-dihydroisoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-dihydroisoindole-5-carboxamide?
The IUPAC name of 2-methyl-1,3-dihydroisoindole-5-carboxamide (CID 84613951) is 2-methyl-1,3-dihydroisoindole-5-carboxamide.
What is the SMILES notation for 2-methyl-1,3-dihydroisoindole-5-carboxamide?
The canonical SMILES for 2-methyl-1,3-dihydroisoindole-5-carboxamide is CN1Cc2ccc(C(N)=O)cc2C1.
What is the InChIKey of 2-methyl-1,3-dihydroisoindole-5-carboxamide?
The InChIKey is SPRLUNSFMIAAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-12-5-8-3-2-7(10(11)13)4-9(8)6-12/h2-4H,5-6H2,1H3,(H2,11,13).
What are the key properties of 2-methyl-1,3-dihydroisoindole-5-carboxamide?
2-methyl-1,3-dihydroisoindole-5-carboxamide has a molecular weight of 176.22 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-dihydroisoindole-5-carboxamide is sourced from PubChem (CID 84613951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).