C16H21N5O2 — CID 84614081
N-(4-aminophenyl)-5-(2-hydroxyethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 84614081) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is N-(4-aminophenyl)-5-(2-hydroxyethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | N-(4-aminophenyl)-5-(2-hydroxyethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84614081 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-(4-aminophenyl)-5-(2-hydroxyethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(N)cc2)c2c1CCN(CCO)C2 |
| InChI | InChI=1S/C16H21N5O2/c1-20-14-6-7-21(8-9-22)10-13(14)15(19-20)16(23)18-12-4-2-11(17)3-5-12/h2-5,22H,6-10,17H2,1H3,(H,18,23) |
| InChIKey | CFMLCGCUSSDQCJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|