C16H24N4 — CID 84615113
N,N-diethyl-4-[3-methyl-4-(methylaminomethyl)pyrazol-1-yl]aniline (PubChem CID 84615113) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N,N-diethyl-4-[3-methyl-4-(methylaminomethyl)pyrazol-1-yl]aniline.
| Compound Name | N,N-diethyl-4-[3-methyl-4-(methylaminomethyl)pyrazol-1-yl]aniline |
|---|---|
| PubChem CID | 84615113 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N,N-diethyl-4-[3-methyl-4-(methylaminomethyl)pyrazol-1-yl]aniline |
| SMILES | CCN(CC)c1ccc(-n2cc(CNC)c(C)n2)cc1 |
| InChI | InChI=1S/C16H24N4/c1-5-19(6-2)15-7-9-16(10-8-15)20-12-14(11-17-4)13(3)18-20/h7-10,12,17H,5-6,11H2,1-4H3 |
| InChIKey | CPCBEKKSOZSVSZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|