About 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one
4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one (PubChem CID 84615410) has the molecular formula C14H16FNO2S
and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one |
| PubChem CID | 84615410 |
| Molecular Formula | C14H16FNO2S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one |
| SMILES | CCC(=O)c1ccc2c(c1)SC(C)C(=O)N2CCF |
| InChI | InChI=1S/C14H16FNO2S/c1-3-12(17)10-4-5-11-13(8-10)19-9(2)14(18)16(11)7-6-15/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | ZODQHAKNSXRVEF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one?
The IUPAC name of 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one (CID 84615410) is 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one.
What is the SMILES notation for 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one?
The canonical SMILES for 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one is CCC(=O)c1ccc2c(c1)SC(C)C(=O)N2CCF.
What is the InChIKey of 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one?
The InChIKey is ZODQHAKNSXRVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO2S/c1-3-12(17)10-4-5-11-13(8-10)19-9(2)14(18)16(11)7-6-15/h4-5,8-9H,3,6-7H2,1-2H3.
What are the key properties of 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one?
4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one has a molecular weight of 281.35 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethyl)-2-methyl-7-propanoyl-1,4-benzothiazin-3-one is sourced from PubChem (CID 84615410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).