About 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one
2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one (PubChem CID 84615413) has the molecular formula C16H21NO2S
and a molecular weight of 291.42 g/mol. Its IUPAC name is 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one |
| PubChem CID | 84615413 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one |
| SMILES | CCCN1C(=O)C(C)(C)Sc2cc(C(=O)CC)ccc21 |
| InChI | InChI=1S/C16H21NO2S/c1-5-9-17-12-8-7-11(13(18)6-2)10-14(12)20-16(3,4)15(17)19/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | MCCJTKYUAAVRQY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one?
The IUPAC name of 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one (CID 84615413) is 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one.
What is the SMILES notation for 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one?
The canonical SMILES for 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one is CCCN1C(=O)C(C)(C)Sc2cc(C(=O)CC)ccc21.
What is the InChIKey of 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one?
The InChIKey is MCCJTKYUAAVRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2S/c1-5-9-17-12-8-7-11(13(18)6-2)10-14(12)20-16(3,4)15(17)19/h7-8,10H,5-6,9H2,1-4H3.
What are the key properties of 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one?
2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one has a molecular weight of 291.42 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-7-propanoyl-4-propyl-1,4-benzothiazin-3-one is sourced from PubChem (CID 84615413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).