About 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one
7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one (PubChem CID 84615707) has the molecular formula C11H12BrNOS
and a molecular weight of 286.19 g/mol. Its IUPAC name is 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one |
| PubChem CID | 84615707 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one |
| SMILES | CC(C)N1C(=O)CSc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H12BrNOS/c1-7(2)13-9-4-3-8(12)5-10(9)15-6-11(13)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | YNQGPDAIEPFPCZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one?
The IUPAC name of 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one (CID 84615707) is 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one.
What is the SMILES notation for 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one?
The canonical SMILES for 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one is CC(C)N1C(=O)CSc2cc(Br)ccc21.
What is the InChIKey of 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one?
The InChIKey is YNQGPDAIEPFPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNOS/c1-7(2)13-9-4-3-8(12)5-10(9)15-6-11(13)14/h3-5,7H,6H2,1-2H3.
What are the key properties of 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one?
7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one has a molecular weight of 286.19 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-propan-2-yl-1,4-benzothiazin-3-one is sourced from PubChem (CID 84615707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).