About 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride
2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride (PubChem CID 84615998) has the molecular formula C12H12ClNO2S2
and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride |
| PubChem CID | 84615998 |
| Molecular Formula | C12H12ClNO2S2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride |
| SMILES | C#CCN1CC(C)Sc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO2S2/c1-3-6-14-8-9(2)17-12-5-4-10(7-11(12)14)18(13,15)16/h1,4-5,7,9H,6,8H2,2H3 |
| InChIKey | NWKUWXZCPRJPKN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride?
The IUPAC name of 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride (CID 84615998) is 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride.
What is the SMILES notation for 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride?
The canonical SMILES for 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride is C#CCN1CC(C)Sc2ccc(S(=O)(=O)Cl)cc21.
What is the InChIKey of 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride?
The InChIKey is NWKUWXZCPRJPKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO2S2/c1-3-6-14-8-9(2)17-12-5-4-10(7-11(12)14)18(13,15)16/h1,4-5,7,9H,6,8H2,2H3.
What are the key properties of 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride?
2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride has a molecular weight of 301.82 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-prop-2-ynyl-2,3-dihydro-1,4-benzothiazine-6-sulfonyl chloride is sourced from PubChem (CID 84615998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).