About 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine
1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine (PubChem CID 84616370) has the molecular formula C13H18N2S2
and a molecular weight of 266.44 g/mol. Its IUPAC name is 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine.
Molecular Properties
| Compound Name | 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine |
| PubChem CID | 84616370 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine |
| SMILES | CCC(N)CSC1=Nc2ccccc2SC1C |
| InChI | InChI=1S/C13H18N2S2/c1-3-10(14)8-16-13-9(2)17-12-7-5-4-6-11(12)15-13/h4-7,9-10H,3,8,14H2,1-2H3 |
| InChIKey | HPGLDEOIKRTIIN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine?
The IUPAC name of 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine (CID 84616370) is 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine.
What is the SMILES notation for 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine?
The canonical SMILES for 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine is CCC(N)CSC1=Nc2ccccc2SC1C.
What is the InChIKey of 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine?
The InChIKey is HPGLDEOIKRTIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2S2/c1-3-10(14)8-16-13-9(2)17-12-7-5-4-6-11(12)15-13/h4-7,9-10H,3,8,14H2,1-2H3.
What are the key properties of 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine?
1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine has a molecular weight of 266.44 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-2H-1,4-benzothiazin-3-yl)sulfanyl]butan-2-amine is sourced from PubChem (CID 84616370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).