About 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide
3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide (PubChem CID 84616832) has the molecular formula C12H16N4S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide.
Molecular Properties
| Compound Name | 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide |
| PubChem CID | 84616832 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide |
| SMILES | [H]/N=C(\N)CCSc1nc2cc(C)c(C)cc2[nH]1 |
| InChI | InChI=1S/C12H16N4S/c1-7-5-9-10(6-8(7)2)16-12(15-9)17-4-3-11(13)14/h5-6H,3-4H2,1-2H3,(H3,13,14)(H,15,16) |
| InChIKey | BMKBLKMYTRQWHF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide?
The IUPAC name of 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide (CID 84616832) is 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide.
What is the SMILES notation for 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide?
The canonical SMILES for 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide is [H]/N=C(\N)CCSc1nc2cc(C)c(C)cc2[nH]1.
What is the InChIKey of 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide?
The InChIKey is BMKBLKMYTRQWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4S/c1-7-5-9-10(6-8(7)2)16-12(15-9)17-4-3-11(13)14/h5-6H,3-4H2,1-2H3,(H3,13,14)(H,15,16).
What are the key properties of 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide?
3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide has a molecular weight of 248.35 g/mol, XLogP of 2.60, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanimidamide is sourced from PubChem (CID 84616832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).