C15H20N4S — CID 84617148
3-[(3-methyl-5,6,7,8-tetrahydrobenzo[f]benzimidazol-2-yl)sulfanyl]propanimidamide (PubChem CID 84617148) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-[(3-methyl-5,6,7,8-tetrahydrobenzo[f]benzimidazol-2-yl)sulfanyl]propanimidamide.
| Compound Name | 3-[(3-methyl-5,6,7,8-tetrahydrobenzo[f]benzimidazol-2-yl)sulfanyl]propanimidamide |
|---|---|
| PubChem CID | 84617148 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[(3-methyl-5,6,7,8-tetrahydrobenzo[f]benzimidazol-2-yl)sulfanyl]propanimidamide |
| SMILES | [H]/N=C(\N)CCSc1nc2cc3c(cc2n1C)CCCC3 |
| InChI | InChI=1S/C15H20N4S/c1-19-13-9-11-5-3-2-4-10(11)8-12(13)18-15(19)20-7-6-14(16)17/h8-9H,2-7H2,1H3,(H3,16,17) |
| InChIKey | RGUQYVSZDMTSPM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|