C10H8N2OS — CID 84617405
2-prop-2-ynylsulfanyl-3H-benzimidazol-5-ol (PubChem CID 84617405) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-prop-2-ynylsulfanyl-3H-benzimidazol-5-ol.
| Compound Name | 2-prop-2-ynylsulfanyl-3H-benzimidazol-5-ol |
|---|---|
| PubChem CID | 84617405 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-prop-2-ynylsulfanyl-3H-benzimidazol-5-ol |
| SMILES | C#CCSc1nc2ccc(O)cc2[nH]1 |
| InChI | InChI=1S/C10H8N2OS/c1-2-5-14-10-11-8-4-3-7(13)6-9(8)12-10/h1,3-4,6,13H,5H2,(H,11,12) |
| InChIKey | VXSCEBKLZLQCNZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|