C15H18N2 — CID 84617985
3-[2-(cyclohexen-1-yl)ethylamino]benzonitrile (PubChem CID 84617985) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethylamino]benzonitrile.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 84617985 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1cccc(NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C15H18N2/c16-12-14-7-4-8-15(11-14)17-10-9-13-5-2-1-3-6-13/h4-5,7-8,11,17H,1-3,6,9-10H2 |
| InChIKey | ZWYGCRUEXIZJIV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|