About 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one
5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 84618269) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one |
| PubChem CID | 84618269 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(CC2)c2cc(N)ccc21 |
| InChI | InChI=1S/C12H14N2O/c1-2-14-10-4-3-8(13)7-9(10)12(5-6-12)11(14)15/h3-4,7H,2,5-6,13H2,1H3 |
| InChIKey | ZLKPRYLCTLOXHP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one?
The IUPAC name of 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one (CID 84618269) is 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one.
What is the SMILES notation for 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one?
The canonical SMILES for 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one is CCN1C(=O)C2(CC2)c2cc(N)ccc21.
What is the InChIKey of 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one?
The InChIKey is ZLKPRYLCTLOXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-2-14-10-4-3-8(13)7-9(10)12(5-6-12)11(14)15/h3-4,7H,2,5-6,13H2,1H3.
What are the key properties of 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one?
5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one has a molecular weight of 202.26 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-amino-1'-ethylspiro[cyclopropane-1,3'-indole]-2'-one is sourced from PubChem (CID 84618269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).