C11H16N2O — CID 84618285
6-amino-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 84618285) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 6-amino-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 6-amino-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 84618285 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 6-amino-1-ethyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CCn1c2c(ccc1=O)CC(N)CC2 |
| InChI | InChI=1S/C11H16N2O/c1-2-13-10-5-4-9(12)7-8(10)3-6-11(13)14/h3,6,9H,2,4-5,7,12H2,1H3 |
| InChIKey | FAFLLIORHPFYFQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |