About (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol
(3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol (PubChem CID 84618456) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol.
Analyze (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol?
The IUPAC name of (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol (CID 84618456) is (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol.
What is the SMILES notation for (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol?
The canonical SMILES for (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol is CC1Nc2ccccc2OC1CO.
What is the InChIKey of (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol?
The InChIKey is IYTZTHBNXKBHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-7-10(6-12)13-9-5-3-2-4-8(9)11-7/h2-5,7,10-12H,6H2,1H3.
What are the key properties of (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol?
(3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol has a molecular weight of 179.22 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol is sourced from PubChem (CID 84618456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).