About 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine
5-ethyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 84618476) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 84618476 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CCc1cccc2c1NCCS2 |
| InChI | InChI=1S/C10H13NS/c1-2-8-4-3-5-9-10(8)11-6-7-12-9/h3-5,11H,2,6-7H2,1H3 |
| InChIKey | GBDMRGVVOQNQNA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine (CID 84618476) is 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine is CCc1cccc2c1NCCS2.
What is the InChIKey of 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is GBDMRGVVOQNQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-2-8-4-3-5-9-10(8)11-6-7-12-9/h3-5,11H,2,6-7H2,1H3.
What are the key properties of 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
5-ethyl-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 179.29 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 84618476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).