About 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile
2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile (PubChem CID 84618680) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile |
| PubChem CID | 84618680 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile |
| SMILES | Cc1cccc2c1OCC(CC#N)N2 |
| InChI | InChI=1S/C11H12N2O/c1-8-3-2-4-10-11(8)14-7-9(13-10)5-6-12/h2-4,9,13H,5,7H2,1H3 |
| InChIKey | DRJAKMNXQKVAHS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile?
The IUPAC name of 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile (CID 84618680) is 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile.
What is the SMILES notation for 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile?
The canonical SMILES for 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile is Cc1cccc2c1OCC(CC#N)N2.
What is the InChIKey of 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile?
The InChIKey is DRJAKMNXQKVAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-8-3-2-4-10-11(8)14-7-9(13-10)5-6-12/h2-4,9,13H,5,7H2,1H3.
What are the key properties of 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile?
2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile has a molecular weight of 188.23 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetonitrile is sourced from PubChem (CID 84618680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).