C13H19N — CID 84618795
3,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline (PubChem CID 84618795) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 3,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 84618795 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3,4,7,8-tetramethyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1ccc2c(c1C)NCC(C)C2C |
| InChI | InChI=1S/C13H19N/c1-8-5-6-12-10(3)9(2)7-14-13(12)11(8)4/h5-6,9-10,14H,7H2,1-4H3 |
| InChIKey | OUHSSESGRZAYCK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |