C12H18N2 — CID 84618965
2,5,6-trimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine (PubChem CID 84618965) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2,5,6-trimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine.
| Compound Name | 2,5,6-trimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 84618965 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2,5,6-trimethyl-1,2,3,4-tetrahydro-1,5-benzodiazepine |
| SMILES | Cc1cccc2c1N(C)CCC(C)N2 |
| InChI | InChI=1S/C12H18N2/c1-9-5-4-6-11-12(9)14(3)8-7-10(2)13-11/h4-6,10,13H,7-8H2,1-3H3 |
| InChIKey | CRKRUPGWOVSMFT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |