About 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile
8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile (PubChem CID 84619055) has the molecular formula C10H9FN2O
and a molecular weight of 192.19 g/mol. Its IUPAC name is 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile.
Molecular Properties
| Compound Name | 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile |
| PubChem CID | 84619055 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile |
| SMILES | CN1c2cccc(F)c2OCC1C#N |
| InChI | InChI=1S/C10H9FN2O/c1-13-7(5-12)6-14-10-8(11)3-2-4-9(10)13/h2-4,7H,6H2,1H3 |
| InChIKey | FWWVCNVWOHEEQK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
The IUPAC name of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile (CID 84619055) is 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile.
What is the SMILES notation for 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
The canonical SMILES for 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile is CN1c2cccc(F)c2OCC1C#N.
What is the InChIKey of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
The InChIKey is FWWVCNVWOHEEQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O/c1-13-7(5-12)6-14-10-8(11)3-2-4-9(10)13/h2-4,7H,6H2,1H3.
What are the key properties of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile has a molecular weight of 192.19 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile is sourced from PubChem (CID 84619055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).