About 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one
6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one (PubChem CID 84619132) has the molecular formula C11H9ClO
and a molecular weight of 192.65 g/mol. Its IUPAC name is 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one.
Molecular Properties
| Compound Name | 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one |
| PubChem CID | 84619132 |
| Molecular Formula | C11H9ClO |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one |
| SMILES | C=C1CCc2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C11H9ClO/c1-7-2-3-8-6-9(12)4-5-10(8)11(7)13/h4-6H,1-3H2 |
| InChIKey | LBXCNSYHCFHBRA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one?
The IUPAC name of 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one (CID 84619132) is 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one.
What is the SMILES notation for 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one?
The canonical SMILES for 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one is C=C1CCc2cc(Cl)ccc2C1=O.
What is the InChIKey of 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one?
The InChIKey is LBXCNSYHCFHBRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO/c1-7-2-3-8-6-9(12)4-5-10(8)11(7)13/h4-6H,1-3H2.
What are the key properties of 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one?
6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one has a molecular weight of 192.65 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methylidene-3,4-dihydronaphthalen-1-one is sourced from PubChem (CID 84619132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).