About 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile
6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile (PubChem CID 84619871) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile |
| PubChem CID | 84619871 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile |
| SMILES | CCc1ccc2c(c1)N(C)C(C#N)CO2 |
| InChI | InChI=1S/C12H14N2O/c1-3-9-4-5-12-11(6-9)14(2)10(7-13)8-15-12/h4-6,10H,3,8H2,1-2H3 |
| InChIKey | FQZRXXLJEJHMRP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
The IUPAC name of 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile (CID 84619871) is 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile.
What is the SMILES notation for 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
The canonical SMILES for 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile is CCc1ccc2c(c1)N(C)C(C#N)CO2.
What is the InChIKey of 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
The InChIKey is FQZRXXLJEJHMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-3-9-4-5-12-11(6-9)14(2)10(7-13)8-15-12/h4-6,10H,3,8H2,1-2H3.
What are the key properties of 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile?
6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile has a molecular weight of 202.26 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carbonitrile is sourced from PubChem (CID 84619871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).