About 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile
2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile (PubChem CID 84619999) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile |
| PubChem CID | 84619999 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile |
| SMILES | CN1c2cccc(N)c2OCC1CC#N |
| InChI | InChI=1S/C11H13N3O/c1-14-8(5-6-12)7-15-11-9(13)3-2-4-10(11)14/h2-4,8H,5,7,13H2,1H3 |
| InChIKey | GSXWLWYNPWUBHN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile?
The IUPAC name of 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile (CID 84619999) is 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile.
What is the SMILES notation for 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile?
The canonical SMILES for 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile is CN1c2cccc(N)c2OCC1CC#N.
What is the InChIKey of 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile?
The InChIKey is GSXWLWYNPWUBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-14-8(5-6-12)7-15-11-9(13)3-2-4-10(11)14/h2-4,8H,5,7,13H2,1H3.
What are the key properties of 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile?
2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile has a molecular weight of 203.25 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-3-yl)acetonitrile is sourced from PubChem (CID 84619999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).