C12H16N2O — CID 84620344
3,6,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 84620344) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,6,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | 3,6,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 84620344 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3,6,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | Cc1cc(C)c2c(c1)NCC(C)C(=O)N2 |
| InChI | InChI=1S/C12H16N2O/c1-7-4-8(2)11-10(5-7)13-6-9(3)12(15)14-11/h4-5,9,13H,6H2,1-3H3,(H,14,15) |
| InChIKey | FGEMXCLWZUADJP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |