About 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline
2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline (PubChem CID 84620477) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 84620477 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline |
| SMILES | CC1CN(C)c2cccc(C(C)C)c2N1 |
| InChI | InChI=1S/C13H20N2/c1-9(2)11-6-5-7-12-13(11)14-10(3)8-15(12)4/h5-7,9-10,14H,8H2,1-4H3 |
| InChIKey | NUPRYKAMRKGESN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline (CID 84620477) is 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline is CC1CN(C)c2cccc(C(C)C)c2N1.
What is the InChIKey of 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline?
The InChIKey is NUPRYKAMRKGESN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-9(2)11-6-5-7-12-13(11)14-10(3)8-15(12)4/h5-7,9-10,14H,8H2,1-4H3.
What are the key properties of 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline?
2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline has a molecular weight of 204.32 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-8-propan-2-yl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 84620477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).