C11H15N3O — CID 84620557
1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-amine (PubChem CID 84620557) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-amine.
| Compound Name | 1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-amine |
|---|---|
| PubChem CID | 84620557 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-amine |
| SMILES | Nc1ccc2c(c1)OCC1CNCCN21 |
| InChI | InChI=1S/C11H15N3O/c12-8-1-2-10-11(5-8)15-7-9-6-13-3-4-14(9)10/h1-2,5,9,13H,3-4,6-7,12H2 |
| InChIKey | VWEBLZLNIOUXQR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|