About 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine
3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 84620973) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 84620973 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CC1CSc2cc(C(C)C)ccc2N1 |
| InChI | InChI=1S/C12H17NS/c1-8(2)10-4-5-11-12(6-10)14-7-9(3)13-11/h4-6,8-9,13H,7H2,1-3H3 |
| InChIKey | UEFQSFZVTMNKEX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine (CID 84620973) is 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine is CC1CSc2cc(C(C)C)ccc2N1.
What is the InChIKey of 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is UEFQSFZVTMNKEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-8(2)10-4-5-11-12(6-10)14-7-9(3)13-11/h4-6,8-9,13H,7H2,1-3H3.
What are the key properties of 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine?
3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 207.34 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-propan-2-yl-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 84620973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).