C12H17NS — CID 84620981
5-ethyl-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 84620981) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 5-ethyl-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 5-ethyl-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 84620981 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 5-ethyl-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CCc1cccc2c1N(C)C(C)CS2 |
| InChI | InChI=1S/C12H17NS/c1-4-10-6-5-7-11-12(10)13(3)9(2)8-14-11/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | YWRBJAJOZPUHNT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |