About N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine
N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine (PubChem CID 84621166) has the molecular formula C11H16N2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine |
| PubChem CID | 84621166 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine |
| SMILES | CNCC1CSc2cccc(C)c2N1 |
| InChI | InChI=1S/C11H16N2S/c1-8-4-3-5-10-11(8)13-9(6-12-2)7-14-10/h3-5,9,12-13H,6-7H2,1-2H3 |
| InChIKey | GFVYUGKNDWPMLS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine?
The IUPAC name of N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine (CID 84621166) is N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine.
What is the SMILES notation for N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine?
The canonical SMILES for N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine is CNCC1CSc2cccc(C)c2N1.
What is the InChIKey of N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine?
The InChIKey is GFVYUGKNDWPMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S/c1-8-4-3-5-10-11(8)13-9(6-12-2)7-14-10/h3-5,9,12-13H,6-7H2,1-2H3.
What are the key properties of N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine?
N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine has a molecular weight of 208.33 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(5-methyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)methanamine is sourced from PubChem (CID 84621166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).