About 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine
2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 84621240) has the molecular formula C12H16FNO
and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 84621240 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC(C)(C)C1CNc2cccc(F)c2O1 |
| InChI | InChI=1S/C12H16FNO/c1-12(2,3)10-7-14-9-6-4-5-8(13)11(9)15-10/h4-6,10,14H,7H2,1-3H3 |
| InChIKey | OBNKTGWKXSERLX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine (CID 84621240) is 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine is CC(C)(C)C1CNc2cccc(F)c2O1.
What is the InChIKey of 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is OBNKTGWKXSERLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO/c1-12(2,3)10-7-14-9-6-4-5-8(13)11(9)15-10/h4-6,10,14H,7H2,1-3H3.
What are the key properties of 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine?
2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 209.26 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 84621240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).