About (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine
(6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine (PubChem CID 84621320) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine |
| PubChem CID | 84621320 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine |
| SMILES | Cc1cc(Cl)cc2c1nc(CN)n2C |
| InChI | InChI=1S/C10H12ClN3/c1-6-3-7(11)4-8-10(6)13-9(5-12)14(8)2/h3-4H,5,12H2,1-2H3 |
| InChIKey | INHDCSQUNJWXRE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine?
The IUPAC name of (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine (CID 84621320) is (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine.
What is the SMILES notation for (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine?
The canonical SMILES for (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine is Cc1cc(Cl)cc2c1nc(CN)n2C.
What is the InChIKey of (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine?
The InChIKey is INHDCSQUNJWXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c1-6-3-7(11)4-8-10(6)13-9(5-12)14(8)2/h3-4H,5,12H2,1-2H3.
What are the key properties of (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine?
(6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine has a molecular weight of 209.68 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,4-dimethylbenzimidazol-2-yl)methanamine is sourced from PubChem (CID 84621320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).